Wiley SpectraBase; SpectraBase Compound ID=YBegkhfEc
http://spectrabase.com/compound/YBegkhfEc (accessed Sep 20, 2020).

SpectraBase Compound ID YBegkhfEc
InChI InChI=1S/C6H4ClN3/c7-5-4-1-2-8-6(4)10-3-9-5/h1-3H,(H,8,9,10)
Mol Weight 153.57 g/mol
Molecular Formula C6H4ClN3
Exact Mass 153.009375 g/mol