Wiley SpectraBase; SpectraBase Compound ID=WdzKY81w6
http://spectrabase.com/compound/WdzKY81w6 (accessed Oct 20, 2020).

SpectraBase Compound ID WdzKY81w6
InChI InChI=1S/C6H10O3/c7-5-3-1-2-4(5)6(8)9/h4-5,7H,1-3H2,(H,8,9)/t4-,5-/m1/s1
Mol Weight 130.14 g/mol
Molecular Formula C6H10O3
Exact Mass 130.062994 g/mol