Wiley SpectraBase; SpectraBase Compound ID=T8Z9q7KEB
http://spectrabase.com/compound/T8Z9q7KEB (accessed Oct 20, 2020).

SpectraBase Compound ID T8Z9q7KEB
InChI InChI=1S/C14H8N2OS/c15-9-10(8-11-4-3-7-17-11)14-16-12-5-1-2-6-13(12)18-14/h1-8H/b10-8+
Mol Weight 252.29 g/mol
Molecular Formula C14H8N2OS
Exact Mass 252.035735 g/mol