Wiley SpectraBase; SpectraBase Compound ID=Qvj8Ju8ex
http://spectrabase.com/compound/Qvj8Ju8ex (accessed Oct 20, 2020).

SpectraBase Compound ID Qvj8Ju8ex
InChI InChI=1S/C9H5NO5/c11-6-1-2-8-5(3-6)4-7(10(13)14)9(12)15-8/h1-4,11H
Mol Weight 207.14 g/mol
Molecular Formula C9H5NO5
Exact Mass 207.016772 g/mol