Wiley SpectraBase; SpectraBase Compound ID=PLE0nA3Jk
http://spectrabase.com/compound/PLE0nA3Jk (accessed Sep 20, 2020).

SpectraBase Compound ID PLE0nA3Jk
InChI InChI=1S/C10H8O2/c11-8-5-1-3-7-4-2-6-9(12)10(7)8/h1-6,11-12H
Mol Weight 160.17 g/mol
Molecular Formula C10H8O2
Exact Mass 160.05243 g/mol