Wiley SpectraBase; SpectraBase Compound ID=Lyfrkik6j
http://spectrabase.com/compound/Lyfrkik6j (accessed Sep 20, 2020).

4-Hydroxy-3-methylbenzoic acid hydrate
SpectraBase Compound ID Lyfrkik6j
InChI InChI=1S/C8H8O3/c1-5-4-6(8(10)11)2-3-7(5)9/h2-4,9H,1H3,(H,10,11)
Mol Weight 152.15 g/mol
Molecular Formula C8H8O3
Exact Mass 152.047344 g/mol