Wiley SpectraBase; SpectraBase Compound ID=LqzcsU32YXe
http://spectrabase.com/compound/LqzcsU32YXe (accessed Jul 14, 2020).

4-nitro-3-phenyl-butyric acid methyl ester
SpectraBase Compound ID LqzcsU32YXe
InChI InChI=1S/C11H13NO4/c1-16-11(13)7-10(8-12(14)15)9-5-3-2-4-6-9/h2-6,10H,7-8H2,1H3
Mol Weight 223.23 g/mol
Molecular Formula C11H13NO4
Exact Mass 223.084458 g/mol