Wiley SpectraBase; SpectraBase Compound ID=Lj155A2ld70
http://spectrabase.com/compound/Lj155A2ld70 (accessed Oct 24, 2020).

CIS-2,6-DIPHENYL-3-METHYL-4-PIPERIDONE
SpectraBase Compound ID Lj155A2ld70
InChI InChI=1S/C18H19NO/c1-13-17(20)12-16(14-8-4-2-5-9-14)19-18(13)15-10-6-3-7-11-15/h2-11,13,16,18-19H,12H2,1H3/t13-,16+,18-/m1/s1
InChIKey IKSGNXSKFBMJLS-RPVQJOFSSA-N
Mol Weight 265.36 g/mol
Molecular Formula C18H19NO
Exact Mass 265.146664 g/mol
Enantiomer InChIKey IKSGNXSKFBMJLS-XCRHUMRWSA-N