Wiley SpectraBase; SpectraBase Compound ID=LKRA1mMP3fh
http://spectrabase.com/compound/LKRA1mMP3fh (accessed Aug 12, 2020).

4-oxo-1,2,3,4-tetrahydro-2-naphthoic acid, methyl ester, semicarbazone
SpectraBase Compound ID LKRA1mMP3fh
InChI InChI=1S/C13H15N3O3/c1-19-12(17)9-6-8-4-2-3-5-10(8)11(7-9)15-16-13(14)18/h2-5,9H,6-7H2,1H3,(H3,14,16,18)/b15-11+
InChIKey WCSZRCBQVHYLIV-RVDMUPIBSA-N
Mol Weight 261.28 g/mol
Molecular Formula C13H15N3O3
Exact Mass 261.111341 g/mol