Wiley SpectraBase; SpectraBase Compound ID=LH6dUJItnxW
http://spectrabase.com/compound/LH6dUJItnxW (accessed Aug 07, 2020).

1-oxo-1,2,2a,8-tetrahydroazeto[2,1-b][1,3]benzoxazine-8-carboxylic acid
SpectraBase Compound ID LH6dUJItnxW
InChI InChI=1S/C11H9NO4/c13-8-5-9-12(8)10(11(14)15)6-3-1-2-4-7(6)16-9/h1-4,9-10H,5H2,(H,14,15)/t9-,10-/m1/s1
InChIKey RSGFNRCFEHTWPZ-NXEZZACHSA-N
Mol Weight 219.2 g/mol
Molecular Formula C11H9NO4
Exact Mass 219.053158 g/mol
Enantiomer InChIKey RSGFNRCFEHTWPZ-UWVGGRQHSA-N