Wiley SpectraBase; SpectraBase Compound ID=Kbi68GTGy
http://spectrabase.com/compound/Kbi68GTGy (accessed Oct 24, 2020).

SpectraBase Compound ID Kbi68GTGy
InChI InChI=1S/C10H14N3O2.BrH/c1-2-15-10(14)8-13-7-6-12(9-13)5-3-4-11;/h6-7,9H,2-3,5,8H2,1H3;1H/q+1;/p-1
Mol Weight 288.14 g/mol
Molecular Formula C10H14BrN3O2
Exact Mass 287.026938 g/mol