Wiley SpectraBase; SpectraBase Compound ID=KNE0GeEOqT3
http://spectrabase.com/compound/KNE0GeEOqT3 (accessed Sep 26, 2020).

8,8-DIMETHYL-ENDO-TRICYCLO-[4.2.1.0(2,4)]-NONAN-7-ONE
SpectraBase Compound ID KNE0GeEOqT3
InChI InChI=1S/C11H16O/c1-11(2)9-5-7(10(11)12)3-6-4-8(6)9/h6-9H,3-5H2,1-2H3/t6-,7-,8+,9-/m1/s1
InChIKey CDUYMGNNIDSYCB-LURQLKTLSA-N
Mol Weight 164.25 g/mol
Molecular Formula C11H16O
Exact Mass 164.120115 g/mol
Enantiomer InChIKey CDUYMGNNIDSYCB-MAUMQABQSA-N