SpectraBase Compound ID | KH8OapUeIh |
---|---|
InChI | InChI=1S/C24H16O5/c25-17-12-19(15-9-5-2-6-10-15)29-24-22-16(14-7-3-1-4-8-14)11-21(27)28-20(22)13-18(26)23(17)24/h1-10,12-13,16,26H,11H2 |
InChIKey | YIJOIOJBZIMTMQ-UHFFFAOYSA-N |
Mol Weight | 384.39 g/mol |
Molecular Formula | C24H16O5 |
Exact Mass | 384.099774 g/mol |
Title | Journal or Book | Year |
---|---|---|
Spectral characters of a complex flavonoid isolated from the farinose exudate of Pityrogramma calomelanos | Phytochemistry | 1993 |
Search your unknown spectrum against the world's largest collection of reference spectra
Offers every student and faculty member unlimited access to millions of spectra and advanced software