SpectraBase Compound ID | JyFSuu23RuT |
---|---|
InChI | InChI=1S/C17H14O6/c1-21-10-6-13(19)16-15(7-10)23-8-11(17(16)20)9-3-4-12(18)14(5-9)22-2/h3-8,18-19H,1-2H3 |
InChIKey | NMQZMHHAWZDJOJ-UHFFFAOYSA-N |
Mol Weight | 314.29 g/mol |
Molecular Formula | C17H14O6 |
Exact Mass | 314.079038 g/mol |
Title | Journal or Book | Year |
---|---|---|
Isoflavones, a sesquiterpene lactone-monoterpene adduct and other constituents of Gaillardia species | Phytochemistry | 1991 |
Search your unknown spectrum against the world's largest collection of reference spectra
Offers every student and faculty member unlimited access to millions of spectra and advanced software