Wiley SpectraBase; SpectraBase Compound ID=Irn1owqNrIB
http://spectrabase.com/compound/Irn1owqNrIB (accessed Oct 24, 2020).

CONOCARPAN;2,3-DIHYDRO-2-(4'-HYDROXYPHENYL)-3-METHYL-5-(E)-PROPENYLBENZOFURAN
SpectraBase Compound ID Irn1owqNrIB
InChI InChI=1S/C18H18O2/c1-3-4-13-5-10-17-16(11-13)12(2)18(20-17)14-6-8-15(19)9-7-14/h3-12,18-19H,1-2H3/b4-3+/t12-,18-/m0/s1
InChIKey GXJSAHXNLJFDPO-OFXNJDNMSA-N
Mol Weight 266.34 g/mol
Molecular Formula C18H18O2
Exact Mass 266.13068 g/mol
Enantiomer InChIKey GXJSAHXNLJFDPO-CGBXWHSCSA-N