SpectraBase Compound ID | Iq7rGoYCEr4 |
---|---|
InChI | InChI=1S/C12H16O4/c1-4-7(2)10(13)5-9-6-11(14)8(3)12(15)16-9/h6-7,14H,4-5H2,1-3H3 |
InChIKey | CRWYBXBKGMHTRM-UHFFFAOYSA-N |
Mol Weight | 224.26 g/mol |
Molecular Formula | C12H16O4 |
Exact Mass | 224.104859 g/mol |
Title | Journal or Book | Year |
---|---|---|
Phomapyrones: Three metabolites from the blackleg fungus | Phytochemistry | 1994 |
Search your unknown spectrum against the world's largest collection of reference spectra
Offers every student and faculty member unlimited access to millions of spectra and advanced software