Wiley SpectraBase; SpectraBase Compound ID=IZcwtc3JRSu
http://spectrabase.com/compound/IZcwtc3JRSu (accessed Jul 15, 2020).

1-ETHYL-BICYCLO-[2.2.1]-HEPTAN-EXO-2-OL
SpectraBase Compound ID IZcwtc3JRSu
InChI InChI=1S/C9H16O/c1-2-9-4-3-7(6-9)5-8(9)10/h7-8,10H,2-6H2,1H3/t7-,8-,9-/m0/s1
InChIKey JNZSIQGJMKNARM-CIUDSAMLSA-N
Mol Weight 140.23 g/mol
Molecular Formula C9H16O
Exact Mass 140.120115 g/mol
Enantiomer InChIKey JNZSIQGJMKNARM-IWSPIJDZSA-N