Wiley SpectraBase; SpectraBase Compound ID=IGxlJxsXurr
http://spectrabase.com/compound/IGxlJxsXurr (accessed Aug 07, 2020).

4-OXIMINOTHIENO-[3,2-B]-QUINOLIZIDINE
SpectraBase Compound ID IGxlJxsXurr
InChI InChI=1S/C11H14N2OS/c14-12-11-8-4-6-15-10(8)7-13-5-2-1-3-9(11)13/h4,6,9,14H,1-3,5,7H2/b12-11+
InChIKey GJBNATSPJXKWLS-VAWYXSNFSA-N
Mol Weight 222.31 g/mol
Molecular Formula C11H14N2OS
Exact Mass 222.082685 g/mol