Wiley SpectraBase; SpectraBase Compound ID=HvnnuOP86b8
http://spectrabase.com/compound/HvnnuOP86b8 (accessed Sep 27, 2020).

SpectraBase Compound ID HvnnuOP86b8
InChI InChI=1S/C14H18/c1-2-6-3-5(1)9-10(6)12-7-4-8-13(11(7)9)14(8)12/h5-14H,1-4H2/t5-,6+,7-,8+,9+,10-,11+,12-,13+,14-
Mol Weight 186.3 g/mol
Molecular Formula C14H18
Exact Mass 186.140851 g/mol