Wiley SpectraBase; SpectraBase Compound ID=HvSZbL1emCc
http://spectrabase.com/compound/HvSZbL1emCc (accessed Jul 15, 2020).

SpectraBase Compound ID HvSZbL1emCc
InChI InChI=1S/C5H6N2O/c1-5-2-3-7(8)4-6-5/h2-4H,1H3
Mol Weight 110.12 g/mol
Molecular Formula C5H6N2O
Exact Mass 110.048013 g/mol