Wiley SpectraBase; SpectraBase Compound ID=HuwDFRx6LeM
http://spectrabase.com/compound/HuwDFRx6LeM (accessed Oct 24, 2020).

2R,6C-DIPHENYL-3-ETHYL-PIPERIDIN-4-ONE
SpectraBase Compound ID HuwDFRx6LeM
InChI InChI=1S/C19H21NO/c1-2-16-18(21)13-17(14-9-5-3-6-10-14)20-19(16)15-11-7-4-8-12-15/h3-12,16-17,19-20H,2,13H2,1H3/t16-,17+,19+/m0/s1
InChIKey MLPXDRONNNYCQN-YQVWRLOYSA-N
Mol Weight 279.38 g/mol
Molecular Formula C19H21NO
Exact Mass 279.162314 g/mol
Enantiomer InChIKey MLPXDRONNNYCQN-AOIWGVFYSA-N