Wiley SpectraBase; SpectraBase Compound ID=HlgFji9YlFc
http://spectrabase.com/compound/HlgFji9YlFc (accessed Aug 09, 2020).

(1R,2R)-N1,N2-ISOBUTYL-3-METHYLENECYCLOPROPANE-1,2-DICARBOXAMIDE
SpectraBase Compound ID HlgFji9YlFc
InChI InChI=1S/C14H24N2O2/c1-8(2)6-15-13(17)11-10(5)12(11)14(18)16-7-9(3)4/h8-9,11-12H,5-7H2,1-4H3,(H,15,17)(H,16,18)/t11-,12-/m0/s1
InChIKey QXMAELAUVZMSMS-RYUDHWBXSA-N
Mol Weight 252.36 g/mol
Molecular Formula C14H24N2O2
Exact Mass 252.183778 g/mol
Enantiomer InChIKey QXMAELAUVZMSMS-VXGBXAGGSA-N