Wiley SpectraBase; SpectraBase Compound ID=HcuUldXDsm
http://spectrabase.com/compound/HcuUldXDsm (accessed Aug 04, 2020).

N-(2-FLUOROPHENYL)-N'-(3-NITROPHENYL)-UREA
SpectraBase Compound ID HcuUldXDsm
InChI InChI=1S/C13H10FN3O3/c14-11-6-1-2-7-12(11)16-13(18)15-9-4-3-5-10(8-9)17(19)20/h1-8H,(H2,15,16,18)
InChIKey XFORTLYKNWQETF-UHFFFAOYSA-N
Mol Weight 275.24 g/mol
Molecular Formula C13H10FN3O3
Exact Mass 275.07062 g/mol