Wiley SpectraBase; SpectraBase Compound ID=HcWAgjia10
http://spectrabase.com/compound/HcWAgjia10 (accessed Aug 04, 2020).

GORMMQIICZJCMO-WCCFOQQASA-N
SpectraBase Compound ID HcWAgjia10
InChI InChI=1S/C14H20O4/c1-13(2)4-8-10(6-13)14(3)5-9(12(16)18-14)11(8)17-7-15/h7-11H,4-6H2,1-3H3/t8-,9-,10+,11+,14+/m1/s1
InChIKey GORMMQIICZJCMO-WCCFOQQASA-N
Mol Weight 252.31 g/mol
Molecular Formula C14H20O4
Exact Mass 252.136159 g/mol
Enantiomer InChIKey GORMMQIICZJCMO-PDNLZKNQSA-N