Wiley SpectraBase; SpectraBase Compound ID=HcMvrg9BUm
http://spectrabase.com/compound/HcMvrg9BUm (accessed Aug 04, 2020).

(2E,9Z)-TETRADECA-2,9-DIENE-1,8-DIOLIDE
SpectraBase Compound ID HcMvrg9BUm
InChI InChI=1S/C14H20O4/c15-13-9-5-1-3-7-11-17-14(16)10-6-2-4-8-12-18-13/h5-6,9-10H,1-4,7-8,11-12H2/b9-5-,10-6+
InChIKey MECNWNHPQZZLMS-VTBWALSUSA-N
Mol Weight 252.31 g/mol
Molecular Formula C14H20O4
Exact Mass 252.136159 g/mol