Wiley SpectraBase; SpectraBase Compound ID=Hc5EeCxMgT
http://spectrabase.com/compound/Hc5EeCxMgT (accessed Aug 12, 2020).

GAMMA-L-GLUTAMYL-S-(ALLYL)-L-CYSTEINE
SpectraBase Compound ID Hc5EeCxMgT
InChI InChI=1S/C11H18N2O5S/c1-2-5-19-6-8(11(17)18)13-9(14)4-3-7(12)10(15)16/h2,7-8H,1,3-6,12H2,(H,13,14)(H,15,16)(H,17,18)/t7-,8-/m0/s1
InChIKey FUTHBNRZCFKVQZ-YUMQZZPRSA-N
Mol Weight 290.33 g/mol
Molecular Formula C11H18N2O5S
Exact Mass 290.093644 g/mol
Enantiomer InChIKey FUTHBNRZCFKVQZ-HTQZYQBOSA-N