Wiley SpectraBase; SpectraBase Compound ID=Ha3ZdPftY7
http://spectrabase.com/compound/Ha3ZdPftY7 (accessed Sep 27, 2020).

2-PHENYLNAPHTHO-[1,2-D]-OXAZOLE
SpectraBase Compound ID Ha3ZdPftY7
InChI InChI=1S/C17H11NO/c1-2-7-13(8-3-1)17-18-16-14-9-5-4-6-12(14)10-11-15(16)19-17/h1-11H
InChIKey IXRXDHFSMJQNMJ-UHFFFAOYSA-N
Mol Weight 245.28 g/mol
Molecular Formula C17H11NO
Exact Mass 245.084064 g/mol