Wiley SpectraBase; SpectraBase Compound ID=HYjet6LR37
http://spectrabase.com/compound/HYjet6LR37 (accessed Aug 12, 2020).

MINOR-ISOMER
SpectraBase Compound ID HYjet6LR37
InChI InChI=1S/C12H8BrNO2/c1-7-6-10-11(13)8-4-2-3-5-9(8)14(10)12(15)16-7/h2-5H,1,6H2
InChIKey BNSDXUHPXRALQL-UHFFFAOYSA-N
Mol Weight 278.1 g/mol
Molecular Formula C12H8BrNO2
Exact Mass 276.97384 g/mol