Wiley SpectraBase; SpectraBase Compound ID=HY485TLANe
http://spectrabase.com/compound/HY485TLANe (accessed Sep 20, 2020).

N-[(p-chlorobenzylidene)amino]phthalimide
SpectraBase Compound ID HY485TLANe
InChI InChI=1S/C15H9ClN2O2/c16-11-7-5-10(6-8-11)9-17-18-14(19)12-3-1-2-4-13(12)15(18)20/h1-9H/b17-9+
InChIKey QLRRDDPNPITBKN-RQZCQDPDSA-N
Mol Weight 284.7 g/mol
Molecular Formula C15H9ClN2O2
Exact Mass 284.035255 g/mol