Wiley SpectraBase; SpectraBase Compound ID=HXhYqRYsxIX
http://spectrabase.com/compound/HXhYqRYsxIX (accessed Oct 24, 2020).

2-{2-[(2-PYRIDYLETHYL)THIO]}-3H-IMIDAZO[4,5-b]PYRIDINE, TRIHYDROCHLORIDE
SpectraBase Compound ID HXhYqRYsxIX
InChI InChI=1S/C13H12N4S.3ClH/c1-2-7-14-10(4-1)6-9-18-13-16-11-5-3-8-15-12(11)17-13;;;/h1-5,7-8H,6,9H2,(H,15,16,17);3*1H
InChIKey MSGZOBYHCXNEST-UHFFFAOYSA-N
Mol Weight 365.71 g/mol
Molecular Formula C13H15Cl3N4S
Exact Mass 364.008302 g/mol
Parent InChIKey UXUVVVGVSHYXDE-UHFFFAOYSA-N