Wiley SpectraBase; SpectraBase Compound ID=HWzfXEkQnF
http://spectrabase.com/compound/HWzfXEkQnF (accessed Aug 04, 2020).

2-(1-butyl-4(1H)-pyridylidene)-1,3-indandione
SpectraBase Compound ID HWzfXEkQnF
InChI InChI=1S/C18H17NO2/c1-2-3-10-19-11-8-13(9-12-19)16-17(20)14-6-4-5-7-15(14)18(16)21/h4-9,11-12H,2-3,10H2,1H3
InChIKey NHMMAEHDXJGRMT-UHFFFAOYSA-N
Mol Weight 279.34 g/mol
Molecular Formula C18H17NO2
Exact Mass 279.125929 g/mol