Wiley SpectraBase; SpectraBase Compound ID=HWIg74plPY
http://spectrabase.com/compound/HWIg74plPY (accessed Aug 08, 2020).

HEXAHYDRO-6alpha-HYDROXY-2,2,3a-TRIMETHYL-1(2H)-PENTALENONE
SpectraBase Compound ID HWIg74plPY
InChI InChI=1S/C11H18O2/c1-10(2)6-11(3)5-4-7(12)8(11)9(10)13/h7-8,12H,4-6H2,1-3H3/t7-,8?,11?/m1/s1
InChIKey GARJDKVIPQIGFK-OBEAGUGNSA-N
Mol Weight 182.26 g/mol
Molecular Formula C11H18O2
Exact Mass 182.13068 g/mol
Enantiomer InChIKey GARJDKVIPQIGFK-JYPKXMCJSA-N