Wiley SpectraBase; SpectraBase Compound ID=HVd2i1GxoZ
http://spectrabase.com/compound/HVd2i1GxoZ (accessed Aug 12, 2020).

4-OXO-5-(2-THENYLIDENE)-DELTA^2^,^alpha-THIAZOLIDINEACETIC ACID, ETHYL ESTER
SpectraBase Compound ID HVd2i1GxoZ
InChI InChI=1S/C12H11NO3S2/c1-2-16-11(14)7-10-13-12(15)9(18-10)6-8-4-3-5-17-8/h3-7H,2H2,1H3,(H,13,15)
InChIKey MVXGCMQJZQYIHH-UHFFFAOYSA-N
Mol Weight 281.34 g/mol
Molecular Formula C12H11NO3S2
Exact Mass 281.018037 g/mol