Wiley SpectraBase; SpectraBase Compound ID=HV2W89ZgrYp
http://spectrabase.com/compound/HV2W89ZgrYp (accessed Aug 12, 2020).

SpectraBase Compound ID HV2W89ZgrYp
InChI InChI=1S/C6H8O2/c7-5-3-1-2(3)4(1)6(5)8/h1-8H/t1-,2+,3-,4+,5-,6+
Mol Weight 112.13 g/mol
Molecular Formula C6H8O2
Exact Mass 112.05243 g/mol