Wiley SpectraBase; SpectraBase Compound ID=HStWhE5iw1q
http://spectrabase.com/compound/HStWhE5iw1q (accessed Aug 07, 2020).

1-(p-chlorophenyl)-3-methyl-4-(phenylazo)-2-pyrazolin-5-one
SpectraBase Compound ID HStWhE5iw1q
InChI InChI=1S/C16H13ClN4O/c1-11-15(19-18-13-5-3-2-4-6-13)16(22)21(20-11)14-9-7-12(17)8-10-14/h2-10,15H,1H3/b19-18+
InChIKey XLBBVSIPVVYADR-VHEBQXMUSA-N
Mol Weight 312.76 g/mol
Molecular Formula C16H13ClN4O
Exact Mass 312.077789 g/mol