Wiley SpectraBase; SpectraBase Compound ID=HSgKeN5GeL
http://spectrabase.com/compound/HSgKeN5GeL (accessed Aug 10, 2020).

N(1),3-DIPHENYL-N(2)-METHYLETHYLENDIAMINE
SpectraBase Compound ID HSgKeN5GeL
InChI InChI=1S/C15H18N2/c1-16-15(13-8-4-2-5-9-13)12-17-14-10-6-3-7-11-14/h2-11,15-17H,12H2,1H3
InChIKey RXDZEHYRIMZYJL-UHFFFAOYSA-N
Mol Weight 226.32 g/mol
Molecular Formula C15H18N2
Exact Mass 226.146999 g/mol