Wiley SpectraBase; SpectraBase Compound ID=HSHPGMkNHPH
http://spectrabase.com/compound/HSHPGMkNHPH (accessed Jul 14, 2020).

REFERENCE
SpectraBase Compound ID HSHPGMkNHPH
InChI InChI=1S/C7H11NO/c8-5-6-2-1-3-7(9)4-6/h6-7,9H,1-4H2/t6-,7-/m1/s1
InChIKey FNARHEUUIFYEIC-RNFRBKRXSA-N
Mol Weight 125.17 g/mol
Molecular Formula C7H11NO
Exact Mass 125.084064 g/mol
Enantiomer InChIKey FNARHEUUIFYEIC-BQBZGAKWSA-N