Wiley SpectraBase; SpectraBase Compound ID=HSCqJaAGCE
http://spectrabase.com/compound/HSCqJaAGCE (accessed Aug 10, 2020).

2-CHLORO-3-METHYLTHIENO-[3,2-B]-QUINOLIZIDIN-4-ONE
SpectraBase Compound ID HSCqJaAGCE
InChI InChI=1S/C12H14ClNOS/c1-7-10-9(16-12(7)13)6-14-5-3-2-4-8(14)11(10)15/h8H,2-6H2,1H3
InChIKey RGBPJSQAVYWRJZ-UHFFFAOYSA-N
Mol Weight 255.76 g/mol
Molecular Formula C12H14ClNOS
Exact Mass 255.048464 g/mol