Wiley SpectraBase; SpectraBase Compound ID=HRw1p8bbGo
http://spectrabase.com/compound/HRw1p8bbGo (accessed Sep 25, 2020).

(Z)-3-CYCLOHEXYL-2-FLUORO-1-PROPENYL-(PHENYL)-IODONIUM-TETRAFLUOROBORATE
SpectraBase Compound ID HRw1p8bbGo
InChI InChI=1S/C15H19FI.BF4/c16-14(11-13-7-3-1-4-8-13)12-17-15-9-5-2-6-10-15;2-1(3,4)5/h2,5-6,9-10,12-13H,1,3-4,7-8,11H2;/q+1;-1/b14-12-;
InChIKey LEDVAOCRBLPRIX-CTMPBGLUSA-N
Mol Weight 432 g/mol
Molecular Formula C15H19BF5I
Exact Mass 432.054474 g/mol
Parent InChIKey HFKPHLBKHLTVKN-OWBHPGMISA-N