Wiley SpectraBase; SpectraBase Compound ID=HRtS9rLZfp
http://spectrabase.com/compound/HRtS9rLZfp (accessed Aug 04, 2020).

DIPLOPHYLLOLIDE A-A
SpectraBase Compound ID HRtS9rLZfp
InChI InChI=1S/C15H20O2/c1-9-5-4-6-15(3)8-13-11(7-12(9)15)10(2)14(16)17-13/h5,11-13H,2,4,6-8H2,1,3H3/t11-,12+,13-,15-/m1/s1
InChIKey PQRAHHQIYITFCT-QVHKTLOISA-N
Mol Weight 232.32 g/mol
Molecular Formula C15H20O2
Exact Mass 232.14633 g/mol
Enantiomer InChIKey PQRAHHQIYITFCT-XFMPKHEZSA-N