Wiley SpectraBase; SpectraBase Compound ID=HRCu6xK25T
http://spectrabase.com/compound/HRCu6xK25T (accessed Sep 25, 2020).

2-(2-methoxy-4-methylphenyl)-1-morpholin-4-ylethanethione
SpectraBase Compound ID HRCu6xK25T
InChI InChI=1S/C14H19NO2S/c1-11-3-4-12(13(9-11)16-2)10-14(18)15-5-7-17-8-6-15/h3-4,9H,5-8,10H2,1-2H3
InChIKey ODVKBOJVYJUYGK-UHFFFAOYSA-N
Mol Weight 265.37 g/mol
Molecular Formula C14H19NO2S
Exact Mass 265.113651 g/mol