Wiley SpectraBase; SpectraBase Compound ID=HRCQoYJzVC
http://spectrabase.com/compound/HRCQoYJzVC (accessed Aug 08, 2020).

4-METHYL-2,3-OCTADIEN-1-NITRILE
SpectraBase Compound ID HRCQoYJzVC
InChI InChI=1S/C9H13N/c1-3-4-6-9(2)7-5-8-10/h5H,3-4,6H2,1-2H3
InChIKey HQDIVHMHTMJXDV-UHFFFAOYSA-N
Mol Weight 135.21 g/mol
Molecular Formula C9H13N
Exact Mass 135.104799 g/mol