Wiley SpectraBase; SpectraBase Compound ID=HPNiJOoOi3
http://spectrabase.com/compound/HPNiJOoOi3 (accessed Aug 12, 2020).

DIHYDROPYROCURZERENONE
SpectraBase Compound ID HPNiJOoOi3
InChI InChI=1S/C15H18O/c1-9-4-5-12-10(2)7-14-15(13(12)6-9)11(3)8-16-14/h7-9H,4-6H2,1-3H3
InChIKey GWQCNWWIXOLIAV-UHFFFAOYSA-N
Mol Weight 214.31 g/mol
Molecular Formula C15H18O
Exact Mass 214.135765 g/mol