Wiley SpectraBase; SpectraBase Compound ID=HNzc5wy7Pt
http://spectrabase.com/compound/HNzc5wy7Pt (accessed Sep 20, 2020).

3-O-METHYL-D-GLUCOSE
SpectraBase Compound ID HNzc5wy7Pt
InChI InChI=1S/C7H14O6/c1-12-6-4(9)3(2-8)13-7(11)5(6)10/h3-11H,2H2,1H3/t3-,4-,5-,6-,7-/m1/s1
InChIKey SCBBSJMAPKXHAH-NYMZXIIRSA-N
Mol Weight 194.18 g/mol
Molecular Formula C7H14O6
Exact Mass 194.079038 g/mol
Enantiomer InChIKey SCBBSJMAPKXHAH-RRNSMKEASA-N