Wiley SpectraBase; SpectraBase Compound ID=HLOHmoX0co
http://spectrabase.com/compound/HLOHmoX0co (accessed Aug 10, 2020).

17-BETA-METHOXY-ESTRA-1,3,5(10)-TRIEN-3-OL
SpectraBase Compound ID HLOHmoX0co
InChI InChI=1S/C19H26O2/c1-19-10-9-15-14-6-4-13(20)11-12(14)3-5-16(15)17(19)7-8-18(19)21-2/h4,6,11,15-18,20H,3,5,7-10H2,1-2H3/t15-,16-,17+,18+,19+/m1/s1
InChIKey FHDRSWJKWSQLTI-GFEQUFNTSA-N
Mol Weight 286.41 g/mol
Molecular Formula C19H26O2
Exact Mass 286.19328 g/mol
Enantiomer InChIKey FHDRSWJKWSQLTI-NTZUZEMLSA-N