Wiley SpectraBase; SpectraBase Compound ID=HKteasmufq
http://spectrabase.com/compound/HKteasmufq (accessed Aug 10, 2020).

1-BENZYL-1-N-BUTYL-BARBITURIC-ACID
SpectraBase Compound ID HKteasmufq
InChI InChI=1S/C15H18N2O3/c1-2-3-9-15(10-11-7-5-4-6-8-11)12(18)16-14(20)17-13(15)19/h4-8H,2-3,9-10H2,1H3,(H2,16,17,18,19,20)
InChIKey XDNQMQVXDKJOET-UHFFFAOYSA-N
Mol Weight 274.32 g/mol
Molecular Formula C15H18N2O3
Exact Mass 274.131743 g/mol