Wiley SpectraBase; SpectraBase Compound ID=HKqzzWf3se
http://spectrabase.com/compound/HKqzzWf3se (accessed Sep 25, 2020).

(7-METHOXY-3,4,5,6-TETRAHYDRO-1H-AZEPINO-[5,4,3-CD]-INDOL-2-YL)-METHANOL
SpectraBase Compound ID HKqzzWf3se
InChI InChI=1S/C13H16N2O2/c1-17-12-3-2-10-13-8(11(7-16)15-10)4-5-14-6-9(12)13/h2-3,14-16H,4-7H2,1H3
InChIKey PNMARSWPMXYDGQ-UHFFFAOYSA-N
Mol Weight 232.28 g/mol
Molecular Formula C13H16N2O2
Exact Mass 232.121178 g/mol