Wiley SpectraBase; SpectraBase Compound ID=HK9Ee3QrW6
http://spectrabase.com/compound/HK9Ee3QrW6 (accessed Aug 05, 2020).

E-3-[2-(4-OXO-1-HEXYL)-PHENYL]-PROPENAL
SpectraBase Compound ID HK9Ee3QrW6
InChI InChI=1S/C15H18O2/c1-2-15(17)11-5-9-13-7-3-4-8-14(13)10-6-12-16/h3-4,6-8,10,12H,2,5,9,11H2,1H3/b10-6+
InChIKey NEASFVXYBLOSAE-UXBLZVDNSA-N
Mol Weight 230.31 g/mol
Molecular Formula C15H18O2
Exact Mass 230.13068 g/mol