Wiley SpectraBase; SpectraBase Compound ID=HK5FIFw5Z2
http://spectrabase.com/compound/HK5FIFw5Z2 (accessed Aug 10, 2020).

TRANS-4-BENZYL-4-METHYL-4-PHOSPHONIATETRACYCLO-[3.3.0.0(2,8).0(3,6)]-OCTANE-BROMIDE
SpectraBase Compound ID HK5FIFw5Z2
InChI InChI=1S/C15H18P.BrH/c1-16(8-9-5-3-2-4-6-9)14-11-7-10-12(14)13(10)15(11)16;/h2-6,10-15H,7-8H2,1H3;1H/q+1;/p-1/t10?,11-,12+,13-,14-,15-,16+;/m0./s1
InChIKey WXWCAJCALPEJIZ-HCYOVXLWSA-M
Mol Weight 309.19 g/mol
Molecular Formula C15H18BrP
Exact Mass 308.03295 g/mol
Parent InChIKey ZIZCWEUGQPOKBD-ZWTQBDGZSA-M
Enantiomer InChIKey WXWCAJCALPEJIZ-WDSLCTAYSA-M