Wiley SpectraBase; SpectraBase Compound ID=HJ6gPN3lEb
http://spectrabase.com/compound/HJ6gPN3lEb (accessed Aug 05, 2020).

2,3-dihydro-3-ethylidenepyrrolo[2,1-b]quinazolin-9(1H)-one
SpectraBase Compound ID HJ6gPN3lEb
InChI InChI=1S/C13H12N2O/c1-2-9-7-8-15-12(9)14-11-6-4-3-5-10(11)13(15)16/h2-6H,7-8H2,1H3
InChIKey IQSIANUOHOJVJK-UHFFFAOYSA-N
Mol Weight 212.25 g/mol
Molecular Formula C13H12N2O
Exact Mass 212.094963 g/mol